C25H48N4O4 — CID 22973499
N-[[formyl-(1-hydroxy-2,2,3,5,6,6-hexamethylpiperidin-4-yl)amino]methyl]-N-(1-hydroxy-2,2,3,5,6,6-hexamethylpiperidin-4-yl)formamide (PubChem CID 22973499) has the molecular formula C25H48N4O4 and a molecular weight of 468.68 g/mol. Its IUPAC name is N-[[formyl-(1-hydroxy-2,2,3,5,6,6-hexamethylpiperidin-4-yl)amino]methyl]-N-(1-hydroxy-2,2,3,5,6,6-hexamethylpiperidin-4-yl)formamide.
| Compound Name | N-[[formyl-(1-hydroxy-2,2,3,5,6,6-hexamethylpiperidin-4-yl)amino]methyl]-N-(1-hydroxy-2,2,3,5,6,6-hexamethylpiperidin-4-yl)formamide |
|---|---|
| PubChem CID | 22973499 |
| Molecular Formula | C25H48N4O4 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.37 |
| IUPAC Name | N-[[formyl-(1-hydroxy-2,2,3,5,6,6-hexamethylpiperidin-4-yl)amino]methyl]-N-(1-hydroxy-2,2,3,5,6,6-hexamethylpiperidin-4-yl)formamide |
| SMILES | CC1C(N(C=O)CN(C=O)C2C(C)C(C)(C)N(O)C(C)(C)C2C)C(C)C(C)(C)N(O)C1(C)C |
| InChI | InChI=1S/C25H48N4O4/c1-16-20(17(2)23(7,8)28(32)22(16,5)6)26(14-30)13-27(15-31)21-18(3)24(9,10)29(33)25(11,12)19(21)4/h14-21,32-33H,13H2,1-12H3 |
| InChIKey | DFQKARUVTPPFFD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|