About 4,5-diethoxy-2-methyl-1,2,4-triazol-3-one
4,5-diethoxy-2-methyl-1,2,4-triazol-3-one (PubChem CID 22973876) has the molecular formula C7H13N3O3
and a molecular weight of 187.20 g/mol. Its IUPAC name is 4,5-diethoxy-2-methyl-1,2,4-triazol-3-one.
Molecular Properties
| Compound Name | 4,5-diethoxy-2-methyl-1,2,4-triazol-3-one |
| PubChem CID | 22973876 |
| Molecular Formula | C7H13N3O3 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 4,5-diethoxy-2-methyl-1,2,4-triazol-3-one |
| SMILES | CCOc1nn(C)c(=O)n1OCC |
| InChI | InChI=1S/C7H13N3O3/c1-4-12-6-8-9(3)7(11)10(6)13-5-2/h4-5H2,1-3H3 |
| InChIKey | DALQXVBOVBLHGL-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 58.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4,5-diethoxy-2-methyl-1,2,4-triazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diethoxy-2-methyl-1,2,4-triazol-3-one?
The IUPAC name of 4,5-diethoxy-2-methyl-1,2,4-triazol-3-one (CID 22973876) is 4,5-diethoxy-2-methyl-1,2,4-triazol-3-one.
What is the SMILES notation for 4,5-diethoxy-2-methyl-1,2,4-triazol-3-one?
The canonical SMILES for 4,5-diethoxy-2-methyl-1,2,4-triazol-3-one is CCOc1nn(C)c(=O)n1OCC.
What is the InChIKey of 4,5-diethoxy-2-methyl-1,2,4-triazol-3-one?
The InChIKey is DALQXVBOVBLHGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O3/c1-4-12-6-8-9(3)7(11)10(6)13-5-2/h4-5H2,1-3H3.
What are the key properties of 4,5-diethoxy-2-methyl-1,2,4-triazol-3-one?
4,5-diethoxy-2-methyl-1,2,4-triazol-3-one has a molecular weight of 187.20 g/mol, XLogP of -0.57, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diethoxy-2-methyl-1,2,4-triazol-3-one is sourced from PubChem (CID 22973876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).