C6H7F7O — CID 22974092
1-ethoxy-1,1,2,2,4,4,4-heptafluorobutane (PubChem CID 22974092) has the molecular formula C6H7F7O and a molecular weight of 228.11 g/mol. Its IUPAC name is 1-ethoxy-1,1,2,2,4,4,4-heptafluorobutane.
| Compound Name | 1-ethoxy-1,1,2,2,4,4,4-heptafluorobutane |
|---|---|
| PubChem CID | 22974092 |
| Molecular Formula | C6H7F7O |
| Molecular Weight | 228.11 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 1-ethoxy-1,1,2,2,4,4,4-heptafluorobutane |
| SMILES | CCOC(F)(F)C(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C6H7F7O/c1-2-14-6(12,13)4(7,8)3-5(9,10)11/h2-3H2,1H3 |
| InChIKey | PIXLIRPSMCCRCY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.11 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|