C23H14O6S2 — CID 22974172
(2Z)-2-[(3-hydroxy-1,1-dioxo-6-phenyl-1-benzothiophen-2-yl)methylidene]-1,1-dioxo-1-benzothiophen-3-one (PubChem CID 22974172) has the molecular formula C23H14O6S2 and a molecular weight of 450.49 g/mol. Its IUPAC name is (2Z)-2-[(3-hydroxy-1,1-dioxo-6-phenyl-1-benzothiophen-2-yl)methylidene]-1,1-dioxo-1-benzothiophen-3-one.
| Compound Name | (2Z)-2-[(3-hydroxy-1,1-dioxo-6-phenyl-1-benzothiophen-2-yl)methylidene]-1,1-dioxo-1-benzothiophen-3-one |
|---|---|
| PubChem CID | 22974172 |
| Molecular Formula | C23H14O6S2 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | (2Z)-2-[(3-hydroxy-1,1-dioxo-6-phenyl-1-benzothiophen-2-yl)methylidene]-1,1-dioxo-1-benzothiophen-3-one |
| SMILES | O=C1/C(=C/C2=C(O)c3ccc(-c4ccccc4)cc3S2(=O)=O)S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C23H14O6S2/c24-22-16-8-4-5-9-18(16)30(26,27)20(22)13-21-23(25)17-11-10-15(12-19(17)31(21,28)29)14-6-2-1-3-7-14/h1-13,25H/b20-13- |
| InChIKey | KZLQQTHGNOEUSF-MOSHPQCFSA-N |
| XLogP | 3.92 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|