About CID 22974341
CID 22974341 (PubChem CID 22974341) has the molecular formula C24H22AlN2O3S
and a molecular weight of 445.50 g/mol.
Molecular Properties
| Compound Name | CID 22974341 |
| PubChem CID | 22974341 |
| Molecular Formula | C24H22AlN2O3S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | — |
| SMILES | Cc1ccc2cccc(N([Al]Oc3c(C)cccc3C)S(=O)(=O)c3ccccc3)c2n1 |
| InChI | InChI=1S/C16H13N2O2S.C8H10O.Al/c1-12-10-11-13-6-5-9-15(16(13)17-12)18-21(19,20)14-7-3-2-4-8-14;1-6-4-3-5-7(2)8(6)9;/h2-11H,1H3;3-5,9H,1-2H3;/q-1;;+2/p-1 |
| InChIKey | GRDYFIXVXPXVAE-UHFFFAOYSA-M |
| XLogP | 4.97 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 22974341 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22974341?
The IUPAC name of CID 22974341 (CID 22974341) is not available.
What is the SMILES notation for CID 22974341?
The canonical SMILES for CID 22974341 is Cc1ccc2cccc(N([Al]Oc3c(C)cccc3C)S(=O)(=O)c3ccccc3)c2n1.
What is the InChIKey of CID 22974341?
The InChIKey is GRDYFIXVXPXVAE-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H13N2O2S.C8H10O.Al/c1-12-10-11-13-6-5-9-15(16(13)17-12)18-21(19,20)14-7-3-2-4-8-14;1-6-4-3-5-7(2)8(6)9;/h2-11H,1H3;3-5,9H,1-2H3;/q-1;;+2/p-1.
What are the key properties of CID 22974341?
CID 22974341 has a molecular weight of 445.50 g/mol, XLogP of 4.97, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22974341 is sourced from PubChem (CID 22974341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).