About 2-tert-butyl-2,3,3-trimethylbutanamide
2-tert-butyl-2,3,3-trimethylbutanamide (PubChem CID 22974377) has the molecular formula C11H23NO
and a molecular weight of 185.31 g/mol. Its IUPAC name is 2-tert-butyl-2,3,3-trimethylbutanamide.
Molecular Properties
| Compound Name | 2-tert-butyl-2,3,3-trimethylbutanamide |
| PubChem CID | 22974377 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | 2-tert-butyl-2,3,3-trimethylbutanamide |
| SMILES | CC(C)(C)C(C)(C(N)=O)C(C)(C)C |
| InChI | InChI=1S/C11H23NO/c1-9(2,3)11(7,8(12)13)10(4,5)6/h1-7H3,(H2,12,13) |
| InChIKey | FGOGOOUULUQXCZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-tert-butyl-2,3,3-trimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-2,3,3-trimethylbutanamide?
The IUPAC name of 2-tert-butyl-2,3,3-trimethylbutanamide (CID 22974377) is 2-tert-butyl-2,3,3-trimethylbutanamide.
What is the SMILES notation for 2-tert-butyl-2,3,3-trimethylbutanamide?
The canonical SMILES for 2-tert-butyl-2,3,3-trimethylbutanamide is CC(C)(C)C(C)(C(N)=O)C(C)(C)C.
What is the InChIKey of 2-tert-butyl-2,3,3-trimethylbutanamide?
The InChIKey is FGOGOOUULUQXCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO/c1-9(2,3)11(7,8(12)13)10(4,5)6/h1-7H3,(H2,12,13).
What are the key properties of 2-tert-butyl-2,3,3-trimethylbutanamide?
2-tert-butyl-2,3,3-trimethylbutanamide has a molecular weight of 185.31 g/mol, XLogP of 2.57, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-2,3,3-trimethylbutanamide is sourced from PubChem (CID 22974377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).