About 3-O-(1-ethoxyethyl) 2-O-(5-oxooxolan-3-yl) 5,6-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxylate
3-O-(1-ethoxyethyl) 2-O-(5-oxooxolan-3-yl) 5,6-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 22974391) has the molecular formula C19H28O7
and a molecular weight of 368.43 g/mol. Its IUPAC name is 3-O-(1-ethoxyethyl) 2-O-(5-oxooxolan-3-yl) 5,6-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxylate.
Molecular Properties
| Compound Name | 3-O-(1-ethoxyethyl) 2-O-(5-oxooxolan-3-yl) 5,6-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxylate |
| PubChem CID | 22974391 |
| Molecular Formula | C19H28O7 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 3-O-(1-ethoxyethyl) 2-O-(5-oxooxolan-3-yl) 5,6-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | CCOC(C)OC(=O)C1C2CC(C(C)C2C)C1C(=O)OC1COC(=O)C1 |
| InChI | InChI=1S/C19H28O7/c1-5-23-11(4)25-18(21)16-13-7-14(10(3)9(13)2)17(16)19(22)26-12-6-15(20)24-8-12/h9-14,16-17H,5-8H2,1-4H3 |
| InChIKey | PVKGYFQURBAMTR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-O-(1-ethoxyethyl) 2-O-(5-oxooxolan-3-yl) 5,6-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-(1-ethoxyethyl) 2-O-(5-oxooxolan-3-yl) 5,6-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxylate?
The IUPAC name of 3-O-(1-ethoxyethyl) 2-O-(5-oxooxolan-3-yl) 5,6-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxylate (CID 22974391) is 3-O-(1-ethoxyethyl) 2-O-(5-oxooxolan-3-yl) 5,6-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxylate.
What is the SMILES notation for 3-O-(1-ethoxyethyl) 2-O-(5-oxooxolan-3-yl) 5,6-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxylate?
The canonical SMILES for 3-O-(1-ethoxyethyl) 2-O-(5-oxooxolan-3-yl) 5,6-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxylate is CCOC(C)OC(=O)C1C2CC(C(C)C2C)C1C(=O)OC1COC(=O)C1.
What is the InChIKey of 3-O-(1-ethoxyethyl) 2-O-(5-oxooxolan-3-yl) 5,6-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxylate?
The InChIKey is PVKGYFQURBAMTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28O7/c1-5-23-11(4)25-18(21)16-13-7-14(10(3)9(13)2)17(16)19(22)26-12-6-15(20)24-8-12/h9-14,16-17H,5-8H2,1-4H3.
What are the key properties of 3-O-(1-ethoxyethyl) 2-O-(5-oxooxolan-3-yl) 5,6-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxylate?
3-O-(1-ethoxyethyl) 2-O-(5-oxooxolan-3-yl) 5,6-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxylate has a molecular weight of 368.43 g/mol, XLogP of 1.93, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-(1-ethoxyethyl) 2-O-(5-oxooxolan-3-yl) 5,6-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxylate is sourced from PubChem (CID 22974391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).