C19H30O7 — CID 22974435
3-O-(ethoxymethyl) 2-O-(4-hydroperoxy-2-methylidenebutyl) 5,6-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 22974435) has the molecular formula C19H30O7 and a molecular weight of 370.44 g/mol. Its IUPAC name is 3-O-(ethoxymethyl) 2-O-(4-hydroperoxy-2-methylidenebutyl) 5,6-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxylate.
| Compound Name | 3-O-(ethoxymethyl) 2-O-(4-hydroperoxy-2-methylidenebutyl) 5,6-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 22974435 |
| Molecular Formula | C19H30O7 |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 3-O-(ethoxymethyl) 2-O-(4-hydroperoxy-2-methylidenebutyl) 5,6-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | C=C(CCOO)COC(=O)C1C2CC(C(C)C2C)C1C(=O)OCOCC |
| InChI | InChI=1S/C19H30O7/c1-5-23-10-25-19(21)17-15-8-14(12(3)13(15)4)16(17)18(20)24-9-11(2)6-7-26-22/h12-17,22H,2,5-10H2,1,3-4H3 |
| InChIKey | UOVZQBBWNNFMKI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|