About dimethyl-(4-oxo-2,3-dihydrochromen-3-yl)sulfanium
dimethyl-(4-oxo-2,3-dihydrochromen-3-yl)sulfanium (PubChem CID 22974592) has the molecular formula C11H13O2S+
and a molecular weight of 209.29 g/mol. Its IUPAC name is dimethyl-(4-oxo-2,3-dihydrochromen-3-yl)sulfanium.
Molecular Properties
| Compound Name | dimethyl-(4-oxo-2,3-dihydrochromen-3-yl)sulfanium |
| PubChem CID | 22974592 |
| Molecular Formula | C11H13O2S+ |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | dimethyl-(4-oxo-2,3-dihydrochromen-3-yl)sulfanium |
| SMILES | C[S+](C)C1COc2ccccc2C1=O |
| InChI | InChI=1S/C11H13O2S/c1-14(2)10-7-13-9-6-4-3-5-8(9)11(10)12/h3-6,10H,7H2,1-2H3/q+1 |
| InChIKey | SZDHSNMKZCLMLO-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-(4-oxo-2,3-dihydrochromen-3-yl)sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-(4-oxo-2,3-dihydrochromen-3-yl)sulfanium?
The IUPAC name of dimethyl-(4-oxo-2,3-dihydrochromen-3-yl)sulfanium (CID 22974592) is dimethyl-(4-oxo-2,3-dihydrochromen-3-yl)sulfanium.
What is the SMILES notation for dimethyl-(4-oxo-2,3-dihydrochromen-3-yl)sulfanium?
The canonical SMILES for dimethyl-(4-oxo-2,3-dihydrochromen-3-yl)sulfanium is C[S+](C)C1COc2ccccc2C1=O.
What is the InChIKey of dimethyl-(4-oxo-2,3-dihydrochromen-3-yl)sulfanium?
The InChIKey is SZDHSNMKZCLMLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13O2S/c1-14(2)10-7-13-9-6-4-3-5-8(9)11(10)12/h3-6,10H,7H2,1-2H3/q+1.
What are the key properties of dimethyl-(4-oxo-2,3-dihydrochromen-3-yl)sulfanium?
dimethyl-(4-oxo-2,3-dihydrochromen-3-yl)sulfanium has a molecular weight of 209.29 g/mol, XLogP of 1.51, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-(4-oxo-2,3-dihydrochromen-3-yl)sulfanium is sourced from PubChem (CID 22974592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).