About 4,5-dipropyl-2H-triazole
4,5-dipropyl-2H-triazole (PubChem CID 22974743) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is 4,5-dipropyl-2H-triazole.
Molecular Properties
| Compound Name | 4,5-dipropyl-2H-triazole |
| PubChem CID | 22974743 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 4,5-dipropyl-2H-triazole |
| SMILES | CCCc1n[nH]nc1CCC |
| InChI | InChI=1S/C8H15N3/c1-3-5-7-8(6-4-2)10-11-9-7/h3-6H2,1-2H3,(H,9,10,11) |
| InChIKey | CIGHXTFKTRRTFA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-dipropyl-2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dipropyl-2H-triazole?
The IUPAC name of 4,5-dipropyl-2H-triazole (CID 22974743) is 4,5-dipropyl-2H-triazole.
What is the SMILES notation for 4,5-dipropyl-2H-triazole?
The canonical SMILES for 4,5-dipropyl-2H-triazole is CCCc1n[nH]nc1CCC.
What is the InChIKey of 4,5-dipropyl-2H-triazole?
The InChIKey is CIGHXTFKTRRTFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3/c1-3-5-7-8(6-4-2)10-11-9-7/h3-6H2,1-2H3,(H,9,10,11).
What are the key properties of 4,5-dipropyl-2H-triazole?
4,5-dipropyl-2H-triazole has a molecular weight of 153.23 g/mol, XLogP of 1.71, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dipropyl-2H-triazole is sourced from PubChem (CID 22974743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).