C15H15ClFN3O2 — CID 22974798
2-(4-chloro-2-fluoro-5-prop-1-en-2-yloxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 22974798) has the molecular formula C15H15ClFN3O2 and a molecular weight of 323.76 g/mol. Its IUPAC name is 2-(4-chloro-2-fluoro-5-prop-1-en-2-yloxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-(4-chloro-2-fluoro-5-prop-1-en-2-yloxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 22974798 |
| Molecular Formula | C15H15ClFN3O2 |
| Molecular Weight | 323.76 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 2-(4-chloro-2-fluoro-5-prop-1-en-2-yloxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | C=C(C)Oc1cc(-n2nc3n(c2=O)CCCC3)c(F)cc1Cl |
| InChI | InChI=1S/C15H15ClFN3O2/c1-9(2)22-13-8-12(11(17)7-10(13)16)20-15(21)19-6-4-3-5-14(19)18-20/h7-8H,1,3-6H2,2H3 |
| InChIKey | GSHXJNDEWKCKOE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.76 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|