About 2-ethyl-3,6-dimethoxy-4,5-dimethyloxane
2-ethyl-3,6-dimethoxy-4,5-dimethyloxane (PubChem CID 22974899) has the molecular formula C11H22O3
and a molecular weight of 202.29 g/mol. Its IUPAC name is 2-ethyl-3,6-dimethoxy-4,5-dimethyloxane.
Molecular Properties
| Compound Name | 2-ethyl-3,6-dimethoxy-4,5-dimethyloxane |
| PubChem CID | 22974899 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 2-ethyl-3,6-dimethoxy-4,5-dimethyloxane |
| SMILES | CCC1OC(OC)C(C)C(C)C1OC |
| InChI | InChI=1S/C11H22O3/c1-6-9-10(12-4)7(2)8(3)11(13-5)14-9/h7-11H,6H2,1-5H3 |
| InChIKey | YYLQYLRPDPFBDD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-3,6-dimethoxy-4,5-dimethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3,6-dimethoxy-4,5-dimethyloxane?
The IUPAC name of 2-ethyl-3,6-dimethoxy-4,5-dimethyloxane (CID 22974899) is 2-ethyl-3,6-dimethoxy-4,5-dimethyloxane.
What is the SMILES notation for 2-ethyl-3,6-dimethoxy-4,5-dimethyloxane?
The canonical SMILES for 2-ethyl-3,6-dimethoxy-4,5-dimethyloxane is CCC1OC(OC)C(C)C(C)C1OC.
What is the InChIKey of 2-ethyl-3,6-dimethoxy-4,5-dimethyloxane?
The InChIKey is YYLQYLRPDPFBDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O3/c1-6-9-10(12-4)7(2)8(3)11(13-5)14-9/h7-11H,6H2,1-5H3.
What are the key properties of 2-ethyl-3,6-dimethoxy-4,5-dimethyloxane?
2-ethyl-3,6-dimethoxy-4,5-dimethyloxane has a molecular weight of 202.29 g/mol, XLogP of 2.05, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3,6-dimethoxy-4,5-dimethyloxane is sourced from PubChem (CID 22974899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).