About 3-(2-bromo-4-methylphenoxy)-N,N-diethylpropan-1-amine
3-(2-bromo-4-methylphenoxy)-N,N-diethylpropan-1-amine (PubChem CID 2297511) has the molecular formula C14H22BrNO
and a molecular weight of 300.24 g/mol. Its IUPAC name is 3-(2-bromo-4-methylphenoxy)-N,N-diethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(2-bromo-4-methylphenoxy)-N,N-diethylpropan-1-amine |
| PubChem CID | 2297511 |
| Molecular Formula | C14H22BrNO |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 3-(2-bromo-4-methylphenoxy)-N,N-diethylpropan-1-amine |
| SMILES | CCN(CC)CCCOc1ccc(C)cc1Br |
| InChI | InChI=1S/C14H22BrNO/c1-4-16(5-2)9-6-10-17-14-8-7-12(3)11-13(14)15/h7-8,11H,4-6,9-10H2,1-3H3 |
| InChIKey | PMMVYKPNUAQVQH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-bromo-4-methylphenoxy)-N,N-diethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-bromo-4-methylphenoxy)-N,N-diethylpropan-1-amine?
The IUPAC name of 3-(2-bromo-4-methylphenoxy)-N,N-diethylpropan-1-amine (CID 2297511) is 3-(2-bromo-4-methylphenoxy)-N,N-diethylpropan-1-amine.
What is the SMILES notation for 3-(2-bromo-4-methylphenoxy)-N,N-diethylpropan-1-amine?
The canonical SMILES for 3-(2-bromo-4-methylphenoxy)-N,N-diethylpropan-1-amine is CCN(CC)CCCOc1ccc(C)cc1Br.
What is the InChIKey of 3-(2-bromo-4-methylphenoxy)-N,N-diethylpropan-1-amine?
The InChIKey is PMMVYKPNUAQVQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22BrNO/c1-4-16(5-2)9-6-10-17-14-8-7-12(3)11-13(14)15/h7-8,11H,4-6,9-10H2,1-3H3.
What are the key properties of 3-(2-bromo-4-methylphenoxy)-N,N-diethylpropan-1-amine?
3-(2-bromo-4-methylphenoxy)-N,N-diethylpropan-1-amine has a molecular weight of 300.24 g/mol, XLogP of 3.87, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-bromo-4-methylphenoxy)-N,N-diethylpropan-1-amine is sourced from PubChem (CID 2297511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).