About 2,6-dimethyl-4H-pyrimidin-4-ide;tris(yttrium)
2,6-dimethyl-4H-pyrimidin-4-ide;tris(yttrium) (PubChem CID 22975312) has the molecular formula C6H7N2Y3-
and a molecular weight of 373.85 g/mol. Its IUPAC name is 2,6-dimethyl-4H-pyrimidin-4-ide;tris(yttrium).
Molecular Properties
| Compound Name | 2,6-dimethyl-4H-pyrimidin-4-ide;tris(yttrium) |
| PubChem CID | 22975312 |
| Molecular Formula | C6H7N2Y3- |
| Molecular Weight | 373.85 g/mol |
| Exact Mass | 373.78 |
| IUPAC Name | 2,6-dimethyl-4H-pyrimidin-4-ide;tris(yttrium) |
| SMILES | Cc1c[c-]nc(C)n1.[Y].[Y].[Y] |
| InChI | InChI=1S/C6H7N2.3Y/c1-5-3-4-7-6(2)8-5;;;/h3H,1-2H3;;;/q-1;;; |
| InChIKey | VZRWLAHRLSGYMT-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.85 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethyl-4H-pyrimidin-4-ide;tris(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-4H-pyrimidin-4-ide;tris(yttrium)?
The IUPAC name of 2,6-dimethyl-4H-pyrimidin-4-ide;tris(yttrium) (CID 22975312) is 2,6-dimethyl-4H-pyrimidin-4-ide;tris(yttrium).
What is the SMILES notation for 2,6-dimethyl-4H-pyrimidin-4-ide;tris(yttrium)?
The canonical SMILES for 2,6-dimethyl-4H-pyrimidin-4-ide;tris(yttrium) is Cc1c[c-]nc(C)n1.[Y].[Y].[Y].
What is the InChIKey of 2,6-dimethyl-4H-pyrimidin-4-ide;tris(yttrium)?
The InChIKey is VZRWLAHRLSGYMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N2.3Y/c1-5-3-4-7-6(2)8-5;;;/h3H,1-2H3;;;/q-1;;;.
What are the key properties of 2,6-dimethyl-4H-pyrimidin-4-ide;tris(yttrium)?
2,6-dimethyl-4H-pyrimidin-4-ide;tris(yttrium) has a molecular weight of 373.85 g/mol, XLogP of 0.89, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-4H-pyrimidin-4-ide;tris(yttrium) is sourced from PubChem (CID 22975312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).