C32H35ClN6O2 — CID 22975368
benzyl N-[N-[2-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)ethyl]-N'-[4-(1H-imidazol-5-yl)butyl]carbamimidoyl]carbamate (PubChem CID 22975368) has the molecular formula C32H35ClN6O2 and a molecular weight of 571.13 g/mol. Its IUPAC name is benzyl N-[N-[2-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)ethyl]-N'-[4-(1H-imidazol-5-yl)butyl]carbamimidoyl]carbamate.
| Compound Name | benzyl N-[N-[2-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)ethyl]-N'-[4-(1H-imidazol-5-yl)butyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 22975368 |
| Molecular Formula | C32H35ClN6O2 |
| Molecular Weight | 571.13 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | benzyl N-[N-[2-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)ethyl]-N'-[4-(1H-imidazol-5-yl)butyl]carbamimidoyl]carbamate |
| SMILES | O=C(N/C(=N\CCCCc1cnc[nH]1)NCCC1c2ccc(Cl)cc2CCc2cccnc21)OCc1ccccc1 |
| InChI | InChI=1S/C32H35ClN6O2/c33-26-13-14-28-25(19-26)12-11-24-9-6-17-35-30(24)29(28)15-18-37-31(36-16-5-4-10-27-20-34-22-38-27)39-32(40)41-21-23-7-2-1-3-8-23/h1-3,6-9,13-14,17,19-20,22,29H,4-5,10-12,15-16,18,21H2,(H,34,38)(H2,36,37,39,40) |
| InChIKey | BWZAULWIOPGVLR-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.13 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|