C10H19N3O — CID 22975580
1,3,8-trimethyl-1,3,8-triazaspiro[4.5]decan-2-one (PubChem CID 22975580) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 1,3,8-trimethyl-1,3,8-triazaspiro[4.5]decan-2-one.
| Compound Name | 1,3,8-trimethyl-1,3,8-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 22975580 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 1,3,8-trimethyl-1,3,8-triazaspiro[4.5]decan-2-one |
| SMILES | CN1CCC2(CC1)CN(C)C(=O)N2C |
| InChI | InChI=1S/C10H19N3O/c1-11-6-4-10(5-7-11)8-12(2)9(14)13(10)3/h4-8H2,1-3H3 |
| InChIKey | VPJBAAQCDCFBEY-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |