About 2,8-dimethyl-2,8-diazaspiro[4.5]decane
2,8-dimethyl-2,8-diazaspiro[4.5]decane (PubChem CID 22975631) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is 2,8-dimethyl-2,8-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 2,8-dimethyl-2,8-diazaspiro[4.5]decane |
| PubChem CID | 22975631 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 2,8-dimethyl-2,8-diazaspiro[4.5]decane |
| SMILES | CN1CCC2(CC1)CCN(C)C2 |
| InChI | InChI=1S/C10H20N2/c1-11-6-3-10(4-7-11)5-8-12(2)9-10/h3-9H2,1-2H3 |
| InChIKey | XCGAGBWTJLMLSN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,8-dimethyl-2,8-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-dimethyl-2,8-diazaspiro[4.5]decane?
The IUPAC name of 2,8-dimethyl-2,8-diazaspiro[4.5]decane (CID 22975631) is 2,8-dimethyl-2,8-diazaspiro[4.5]decane.
What is the SMILES notation for 2,8-dimethyl-2,8-diazaspiro[4.5]decane?
The canonical SMILES for 2,8-dimethyl-2,8-diazaspiro[4.5]decane is CN1CCC2(CC1)CCN(C)C2.
What is the InChIKey of 2,8-dimethyl-2,8-diazaspiro[4.5]decane?
The InChIKey is XCGAGBWTJLMLSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2/c1-11-6-3-10(4-7-11)5-8-12(2)9-10/h3-9H2,1-2H3.
What are the key properties of 2,8-dimethyl-2,8-diazaspiro[4.5]decane?
2,8-dimethyl-2,8-diazaspiro[4.5]decane has a molecular weight of 168.28 g/mol, XLogP of 1.03, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-dimethyl-2,8-diazaspiro[4.5]decane is sourced from PubChem (CID 22975631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).