C15H15N3O3S — CID 22976079
(4Z)-N-(2-methoxyethyl)-5-oxo-4-(1H-pyrrol-2-ylmethylidene)-6H-thieno[2,3-b]pyrrole-2-carboxamide (PubChem CID 22976079) has the molecular formula C15H15N3O3S and a molecular weight of 317.37 g/mol. Its IUPAC name is (4Z)-N-(2-methoxyethyl)-5-oxo-4-(1H-pyrrol-2-ylmethylidene)-6H-thieno[2,3-b]pyrrole-2-carboxamide.
| Compound Name | (4Z)-N-(2-methoxyethyl)-5-oxo-4-(1H-pyrrol-2-ylmethylidene)-6H-thieno[2,3-b]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 22976079 |
| Molecular Formula | C15H15N3O3S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | (4Z)-N-(2-methoxyethyl)-5-oxo-4-(1H-pyrrol-2-ylmethylidene)-6H-thieno[2,3-b]pyrrole-2-carboxamide |
| SMILES | COCCNC(=O)c1cc2c(s1)NC(=O)/C2=C\c1ccc[nH]1 |
| InChI | InChI=1S/C15H15N3O3S/c1-21-6-5-17-14(20)12-8-11-10(7-9-3-2-4-16-9)13(19)18-15(11)22-12/h2-4,7-8,16H,5-6H2,1H3,(H,17,20)(H,18,19)/b10-7- |
| InChIKey | ZEKNBXVGVUVBMY-YFHOEESVSA-N |
| XLogP | 1.95 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|