C37H62O4 — CID 22976386
[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 5-(2-methylbutanoyloxy)pentanoate (PubChem CID 22976386) has the molecular formula C37H62O4 and a molecular weight of 570.90 g/mol. Its IUPAC name is [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 5-(2-methylbutanoyloxy)pentanoate.
| Compound Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 5-(2-methylbutanoyloxy)pentanoate |
|---|---|
| PubChem CID | 22976386 |
| Molecular Formula | C37H62O4 |
| Molecular Weight | 570.90 g/mol |
| Exact Mass | 570.46 |
| IUPAC Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 5-(2-methylbutanoyloxy)pentanoate |
| SMILES | CCC(C)C(=O)OCCCCC(=O)OC1CCC2(C)C(=CCC3C2CCC2(C)C(C(C)CCCC(C)C)CCC32)C1 |
| InChI | InChI=1S/C37H62O4/c1-8-26(4)35(39)40-23-10-9-14-34(38)41-29-19-21-36(6)28(24-29)15-16-30-32-18-17-31(27(5)13-11-12-25(2)3)37(32,7)22-20-33(30)36/h15,25-27,29-33H,8-14,16-24H2,1-7H3 |
| InChIKey | AXAKFBMMJJYNCH-UHFFFAOYSA-N |
| XLogP | 9.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.90 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|