About 2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl-trimethylazanium
2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl-trimethylazanium (PubChem CID 22977235) has the molecular formula C8H21N4+
and a molecular weight of 173.28 g/mol. Its IUPAC name is 2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl-trimethylazanium.
Molecular Properties
| Compound Name | 2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl-trimethylazanium |
| PubChem CID | 22977235 |
| Molecular Formula | C8H21N4+ |
| Molecular Weight | 173.28 g/mol |
| Exact Mass | 173.18 |
| IUPAC Name | 2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl-trimethylazanium |
| SMILES | C/N=C(\NC)NCC[N+](C)(C)C |
| InChI | InChI=1S/C8H21N4/c1-9-8(10-2)11-6-7-12(3,4)5/h6-7H2,1-5H3,(H2,9,10,11)/q+1 |
| InChIKey | HURPHXUNBNYENW-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.28 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl-trimethylazanium?
The IUPAC name of 2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl-trimethylazanium (CID 22977235) is 2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl-trimethylazanium.
What is the SMILES notation for 2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl-trimethylazanium?
The canonical SMILES for 2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl-trimethylazanium is C/N=C(\NC)NCC[N+](C)(C)C.
What is the InChIKey of 2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl-trimethylazanium?
The InChIKey is HURPHXUNBNYENW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H21N4/c1-9-8(10-2)11-6-7-12(3,4)5/h6-7H2,1-5H3,(H2,9,10,11)/q+1.
What are the key properties of 2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl-trimethylazanium?
2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl-trimethylazanium has a molecular weight of 173.28 g/mol, XLogP of -0.51, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl-trimethylazanium is sourced from PubChem (CID 22977235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).