About N-ethyl-N'-methylpyrrolidine-1-carboximidamide
N-ethyl-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 22977263) has the molecular formula C8H17N3
and a molecular weight of 155.25 g/mol. Its IUPAC name is N-ethyl-N'-methylpyrrolidine-1-carboximidamide.
Molecular Properties
| Compound Name | N-ethyl-N'-methylpyrrolidine-1-carboximidamide |
| PubChem CID | 22977263 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.25 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | N-ethyl-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\C)N1CCCC1 |
| InChI | InChI=1S/C8H17N3/c1-3-10-8(9-2)11-6-4-5-7-11/h3-7H2,1-2H3,(H,9,10) |
| InChIKey | QOHQTCAPNULXHR-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.25 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N'-methylpyrrolidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N'-methylpyrrolidine-1-carboximidamide?
The IUPAC name of N-ethyl-N'-methylpyrrolidine-1-carboximidamide (CID 22977263) is N-ethyl-N'-methylpyrrolidine-1-carboximidamide.
What is the SMILES notation for N-ethyl-N'-methylpyrrolidine-1-carboximidamide?
The canonical SMILES for N-ethyl-N'-methylpyrrolidine-1-carboximidamide is CCN/C(=N\C)N1CCCC1.
What is the InChIKey of N-ethyl-N'-methylpyrrolidine-1-carboximidamide?
The InChIKey is QOHQTCAPNULXHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3/c1-3-10-8(9-2)11-6-4-5-7-11/h3-7H2,1-2H3,(H,9,10).
What are the key properties of N-ethyl-N'-methylpyrrolidine-1-carboximidamide?
N-ethyl-N'-methylpyrrolidine-1-carboximidamide has a molecular weight of 155.25 g/mol, XLogP of 0.68, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N'-methylpyrrolidine-1-carboximidamide is sourced from PubChem (CID 22977263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).