About (5S)-5-(azidomethyl)-3-(1-tritylindazol-5-yl)-1,3-oxazolidin-2-one
(5S)-5-(azidomethyl)-3-(1-tritylindazol-5-yl)-1,3-oxazolidin-2-one (PubChem CID 22977310) has the molecular formula C30H24N6O2
and a molecular weight of 500.56 g/mol. Its IUPAC name is (5S)-5-(azidomethyl)-3-(1-tritylindazol-5-yl)-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (5S)-5-(azidomethyl)-3-(1-tritylindazol-5-yl)-1,3-oxazolidin-2-one |
| PubChem CID | 22977310 |
| Molecular Formula | C30H24N6O2 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | (5S)-5-(azidomethyl)-3-(1-tritylindazol-5-yl)-1,3-oxazolidin-2-one |
| SMILES | [N-]=[N+]=NC[C@@H]1CN(c2ccc3c(cnn3C(c3ccccc3)(c3ccccc3)c3ccccc3)c2)C(=O)O1 |
| InChI | InChI=1S/C30H24N6O2/c31-34-32-20-27-21-35(29(37)38-27)26-16-17-28-22(18-26)19-33-36(28)30(23-10-4-1-5-11-23,24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-19,27H,20-21H2/t27-/m1/s1 |
| InChIKey | PLUDEBKDXBSJSC-HHHXNRCGSA-N |
| XLogP | 6.51 |
| TPSA | 96.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze (5S)-5-(azidomethyl)-3-(1-tritylindazol-5-yl)-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-(azidomethyl)-3-(1-tritylindazol-5-yl)-1,3-oxazolidin-2-one?
The IUPAC name of (5S)-5-(azidomethyl)-3-(1-tritylindazol-5-yl)-1,3-oxazolidin-2-one (CID 22977310) is (5S)-5-(azidomethyl)-3-(1-tritylindazol-5-yl)-1,3-oxazolidin-2-one.
What is the SMILES notation for (5S)-5-(azidomethyl)-3-(1-tritylindazol-5-yl)-1,3-oxazolidin-2-one?
The canonical SMILES for (5S)-5-(azidomethyl)-3-(1-tritylindazol-5-yl)-1,3-oxazolidin-2-one is [N-]=[N+]=NC[C@@H]1CN(c2ccc3c(cnn3C(c3ccccc3)(c3ccccc3)c3ccccc3)c2)C(=O)O1.
What is the InChIKey of (5S)-5-(azidomethyl)-3-(1-tritylindazol-5-yl)-1,3-oxazolidin-2-one?
The InChIKey is PLUDEBKDXBSJSC-HHHXNRCGSA-N. The full InChI is InChI=1S/C30H24N6O2/c31-34-32-20-27-21-35(29(37)38-27)26-16-17-28-22(18-26)19-33-36(28)30(23-10-4-1-5-11-23,24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-19,27H,20-21H2/t27-/m1/s1.
What are the key properties of (5S)-5-(azidomethyl)-3-(1-tritylindazol-5-yl)-1,3-oxazolidin-2-one?
(5S)-5-(azidomethyl)-3-(1-tritylindazol-5-yl)-1,3-oxazolidin-2-one has a molecular weight of 500.56 g/mol, XLogP of 6.51, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-(azidomethyl)-3-(1-tritylindazol-5-yl)-1,3-oxazolidin-2-one is sourced from PubChem (CID 22977310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).