About CID 22977915
CID 22977915 (PubChem CID 22977915) has the molecular formula C11H14BNOS
and a molecular weight of 219.12 g/mol.
Molecular Properties
| Compound Name | CID 22977915 |
| PubChem CID | 22977915 |
| Molecular Formula | C11H14BNOS |
| Molecular Weight | 219.12 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | — |
| SMILES | [B]SOCC1CNCC1c1ccccc1 |
| InChI | InChI=1S/C11H14BNOS/c12-15-14-8-10-6-13-7-11(10)9-4-2-1-3-5-9/h1-5,10-11,13H,6-8H2 |
| InChIKey | JAPQJIKMBJOJPY-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.12 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 22977915 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22977915?
The IUPAC name of CID 22977915 (CID 22977915) is not available.
What is the SMILES notation for CID 22977915?
The canonical SMILES for CID 22977915 is [B]SOCC1CNCC1c1ccccc1.
What is the InChIKey of CID 22977915?
The InChIKey is JAPQJIKMBJOJPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BNOS/c12-15-14-8-10-6-13-7-11(10)9-4-2-1-3-5-9/h1-5,10-11,13H,6-8H2.
What are the key properties of CID 22977915?
CID 22977915 has a molecular weight of 219.12 g/mol, XLogP of 1.74, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22977915 is sourced from PubChem (CID 22977915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).