C24H28F6O3 — CID 22977924
ethyl 7-[(1S,2S)-2-[2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-5-oxocyclopentyl]heptanoate (PubChem CID 22977924) has the molecular formula C24H28F6O3 and a molecular weight of 478.47 g/mol. Its IUPAC name is ethyl 7-[(1S,2S)-2-[2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-5-oxocyclopentyl]heptanoate.
| Compound Name | ethyl 7-[(1S,2S)-2-[2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 22977924 |
| Molecular Formula | C24H28F6O3 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | ethyl 7-[(1S,2S)-2-[2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-5-oxocyclopentyl]heptanoate |
| SMILES | CCOC(=O)CCCCCC[C@@H]1C(=O)CC[C@H]1C=Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H28F6O3/c1-2-33-22(32)8-6-4-3-5-7-20-17(11-12-21(20)31)10-9-16-13-18(23(25,26)27)15-19(14-16)24(28,29)30/h9-10,13-15,17,20H,2-8,11-12H2,1H3/t17-,20+/m1/s1 |
| InChIKey | KUSJFVWXLUFDFX-XLIONFOSSA-N |
| XLogP | 7.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|