About 6-[2-[(1S,2S)-2-(6-carboxyhexyl)-3-oxocyclopentyl]ethenyl]-2-oxochromene-3-carboxylic acid
6-[2-[(1S,2S)-2-(6-carboxyhexyl)-3-oxocyclopentyl]ethenyl]-2-oxochromene-3-carboxylic acid (PubChem CID 22977926) has the molecular formula C24H26O7
and a molecular weight of 426.47 g/mol. Its IUPAC name is 6-[2-[(1S,2S)-2-(6-carboxyhexyl)-3-oxocyclopentyl]ethenyl]-2-oxochromene-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-[2-[(1S,2S)-2-(6-carboxyhexyl)-3-oxocyclopentyl]ethenyl]-2-oxochromene-3-carboxylic acid |
| PubChem CID | 22977926 |
| Molecular Formula | C24H26O7 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 6-[2-[(1S,2S)-2-(6-carboxyhexyl)-3-oxocyclopentyl]ethenyl]-2-oxochromene-3-carboxylic acid |
| SMILES | O=C(O)CCCCCC[C@@H]1C(=O)CC[C@H]1C=Cc1ccc2oc(=O)c(C(=O)O)cc2c1 |
| InChI | InChI=1S/C24H26O7/c25-20-11-10-16(18(20)5-3-1-2-4-6-22(26)27)9-7-15-8-12-21-17(13-15)14-19(23(28)29)24(30)31-21/h7-9,12-14,16,18H,1-6,10-11H2,(H,26,27)(H,28,29)/t16-,18+/m1/s1 |
| InChIKey | VNLCGOAFQFELFW-AEFFLSMTSA-N |
| XLogP | 4.52 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 6-[2-[(1S,2S)-2-(6-carboxyhexyl)-3-oxocyclopentyl]ethenyl]-2-oxochromene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-[(1S,2S)-2-(6-carboxyhexyl)-3-oxocyclopentyl]ethenyl]-2-oxochromene-3-carboxylic acid?
The IUPAC name of 6-[2-[(1S,2S)-2-(6-carboxyhexyl)-3-oxocyclopentyl]ethenyl]-2-oxochromene-3-carboxylic acid (CID 22977926) is 6-[2-[(1S,2S)-2-(6-carboxyhexyl)-3-oxocyclopentyl]ethenyl]-2-oxochromene-3-carboxylic acid.
What is the SMILES notation for 6-[2-[(1S,2S)-2-(6-carboxyhexyl)-3-oxocyclopentyl]ethenyl]-2-oxochromene-3-carboxylic acid?
The canonical SMILES for 6-[2-[(1S,2S)-2-(6-carboxyhexyl)-3-oxocyclopentyl]ethenyl]-2-oxochromene-3-carboxylic acid is O=C(O)CCCCCC[C@@H]1C(=O)CC[C@H]1C=Cc1ccc2oc(=O)c(C(=O)O)cc2c1.
What is the InChIKey of 6-[2-[(1S,2S)-2-(6-carboxyhexyl)-3-oxocyclopentyl]ethenyl]-2-oxochromene-3-carboxylic acid?
The InChIKey is VNLCGOAFQFELFW-AEFFLSMTSA-N. The full InChI is InChI=1S/C24H26O7/c25-20-11-10-16(18(20)5-3-1-2-4-6-22(26)27)9-7-15-8-12-21-17(13-15)14-19(23(28)29)24(30)31-21/h7-9,12-14,16,18H,1-6,10-11H2,(H,26,27)(H,28,29)/t16-,18+/m1/s1.
What are the key properties of 6-[2-[(1S,2S)-2-(6-carboxyhexyl)-3-oxocyclopentyl]ethenyl]-2-oxochromene-3-carboxylic acid?
6-[2-[(1S,2S)-2-(6-carboxyhexyl)-3-oxocyclopentyl]ethenyl]-2-oxochromene-3-carboxylic acid has a molecular weight of 426.47 g/mol, XLogP of 4.52, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-[(1S,2S)-2-(6-carboxyhexyl)-3-oxocyclopentyl]ethenyl]-2-oxochromene-3-carboxylic acid is sourced from PubChem (CID 22977926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).