C21H27FO4 — CID 22977958
7-[(1S,2S,3R)-2-[2-(4-fluoro-3-methylphenyl)ethenyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid (PubChem CID 22977958) has the molecular formula C21H27FO4 and a molecular weight of 362.44 g/mol. Its IUPAC name is 7-[(1S,2S,3R)-2-[2-(4-fluoro-3-methylphenyl)ethenyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1S,2S,3R)-2-[2-(4-fluoro-3-methylphenyl)ethenyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 22977958 |
| Molecular Formula | C21H27FO4 |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 7-[(1S,2S,3R)-2-[2-(4-fluoro-3-methylphenyl)ethenyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid |
| SMILES | Cc1cc(C=C[C@@H]2[C@H](O)CC(=O)[C@H]2CCCCCCC(=O)O)ccc1F |
| InChI | InChI=1S/C21H27FO4/c1-14-12-15(9-11-18(14)22)8-10-17-16(19(23)13-20(17)24)6-4-2-3-5-7-21(25)26/h8-12,16-17,20,24H,2-7,13H2,1H3,(H,25,26)/t16-,17-,20+/m0/s1 |
| InChIKey | UWIWWWDKOKFLNP-ABSDTBQOSA-N |
| XLogP | 4.14 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|