About 3-[(E)-2-(2,6-dichlorophenyl)ethenyl]-6-pyridin-4-yl-1H-indazole
3-[(E)-2-(2,6-dichlorophenyl)ethenyl]-6-pyridin-4-yl-1H-indazole (PubChem CID 22978121) has the molecular formula C20H13Cl2N3
and a molecular weight of 366.25 g/mol. Its IUPAC name is 3-[(E)-2-(2,6-dichlorophenyl)ethenyl]-6-pyridin-4-yl-1H-indazole.
Molecular Properties
| Compound Name | 3-[(E)-2-(2,6-dichlorophenyl)ethenyl]-6-pyridin-4-yl-1H-indazole |
| PubChem CID | 22978121 |
| Molecular Formula | C20H13Cl2N3 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 3-[(E)-2-(2,6-dichlorophenyl)ethenyl]-6-pyridin-4-yl-1H-indazole |
| SMILES | Clc1cccc(Cl)c1/C=C/c1n[nH]c2cc(-c3ccncc3)ccc12 |
| InChI | InChI=1S/C20H13Cl2N3/c21-17-2-1-3-18(22)15(17)6-7-19-16-5-4-14(12-20(16)25-24-19)13-8-10-23-11-9-13/h1-12H,(H,24,25)/b7-6+ |
| InChIKey | WPNXXBKHAHMBEV-VOTSOKGWSA-N |
| XLogP | 6.10 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(E)-2-(2,6-dichlorophenyl)ethenyl]-6-pyridin-4-yl-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-2-(2,6-dichlorophenyl)ethenyl]-6-pyridin-4-yl-1H-indazole?
The IUPAC name of 3-[(E)-2-(2,6-dichlorophenyl)ethenyl]-6-pyridin-4-yl-1H-indazole (CID 22978121) is 3-[(E)-2-(2,6-dichlorophenyl)ethenyl]-6-pyridin-4-yl-1H-indazole.
What is the SMILES notation for 3-[(E)-2-(2,6-dichlorophenyl)ethenyl]-6-pyridin-4-yl-1H-indazole?
The canonical SMILES for 3-[(E)-2-(2,6-dichlorophenyl)ethenyl]-6-pyridin-4-yl-1H-indazole is Clc1cccc(Cl)c1/C=C/c1n[nH]c2cc(-c3ccncc3)ccc12.
What is the InChIKey of 3-[(E)-2-(2,6-dichlorophenyl)ethenyl]-6-pyridin-4-yl-1H-indazole?
The InChIKey is WPNXXBKHAHMBEV-VOTSOKGWSA-N. The full InChI is InChI=1S/C20H13Cl2N3/c21-17-2-1-3-18(22)15(17)6-7-19-16-5-4-14(12-20(16)25-24-19)13-8-10-23-11-9-13/h1-12H,(H,24,25)/b7-6+.
What are the key properties of 3-[(E)-2-(2,6-dichlorophenyl)ethenyl]-6-pyridin-4-yl-1H-indazole?
3-[(E)-2-(2,6-dichlorophenyl)ethenyl]-6-pyridin-4-yl-1H-indazole has a molecular weight of 366.25 g/mol, XLogP of 6.10, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-2-(2,6-dichlorophenyl)ethenyl]-6-pyridin-4-yl-1H-indazole is sourced from PubChem (CID 22978121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).