C15H9NO5S2 — CID 22978627
3-[(1,1-dioxo-1,4,2-dithiazol-3-yl)oxy]xanthen-9-one (PubChem CID 22978627) has the molecular formula C15H9NO5S2 and a molecular weight of 347.37 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,4,2-dithiazol-3-yl)oxy]xanthen-9-one.
| Compound Name | 3-[(1,1-dioxo-1,4,2-dithiazol-3-yl)oxy]xanthen-9-one |
|---|---|
| PubChem CID | 22978627 |
| Molecular Formula | C15H9NO5S2 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | 3-[(1,1-dioxo-1,4,2-dithiazol-3-yl)oxy]xanthen-9-one |
| SMILES | O=c1c2ccccc2oc2cc(OC3=NS(=O)(=O)CS3)ccc12 |
| InChI | InChI=1S/C15H9NO5S2/c17-14-10-3-1-2-4-12(10)21-13-7-9(5-6-11(13)14)20-15-16-23(18,19)8-22-15/h1-7H,8H2 |
| InChIKey | YHXMAUUCXAKTLI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 85.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|