About 1-cyclobutyl-3-octylurea
1-cyclobutyl-3-octylurea (PubChem CID 22978784) has the molecular formula C13H26N2O
and a molecular weight of 226.36 g/mol. Its IUPAC name is 1-cyclobutyl-3-octylurea.
Molecular Properties
| Compound Name | 1-cyclobutyl-3-octylurea |
| PubChem CID | 22978784 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 1-cyclobutyl-3-octylurea |
| SMILES | CCCCCCCCNC(=O)NC1CCC1 |
| InChI | InChI=1S/C13H26N2O/c1-2-3-4-5-6-7-11-14-13(16)15-12-9-8-10-12/h12H,2-11H2,1H3,(H2,14,15,16) |
| InChIKey | JGMHOQDKAXFSGF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclobutyl-3-octylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclobutyl-3-octylurea?
The IUPAC name of 1-cyclobutyl-3-octylurea (CID 22978784) is 1-cyclobutyl-3-octylurea.
What is the SMILES notation for 1-cyclobutyl-3-octylurea?
The canonical SMILES for 1-cyclobutyl-3-octylurea is CCCCCCCCNC(=O)NC1CCC1.
What is the InChIKey of 1-cyclobutyl-3-octylurea?
The InChIKey is JGMHOQDKAXFSGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O/c1-2-3-4-5-6-7-11-14-13(16)15-12-9-8-10-12/h12H,2-11H2,1H3,(H2,14,15,16).
What are the key properties of 1-cyclobutyl-3-octylurea?
1-cyclobutyl-3-octylurea has a molecular weight of 226.36 g/mol, XLogP of 3.20, 8 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclobutyl-3-octylurea is sourced from PubChem (CID 22978784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).