C17H27N7O7S2 — CID 22979209
2-[[4-[2-(ethylsulfonylamino)ethyl-(2-hydroxyethyl)amino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]ethanesulfonic acid (PubChem CID 22979209) has the molecular formula C17H27N7O7S2 and a molecular weight of 505.58 g/mol. Its IUPAC name is 2-[[4-[2-(ethylsulfonylamino)ethyl-(2-hydroxyethyl)amino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[2-(ethylsulfonylamino)ethyl-(2-hydroxyethyl)amino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 22979209 |
| Molecular Formula | C17H27N7O7S2 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | 2-[[4-[2-(ethylsulfonylamino)ethyl-(2-hydroxyethyl)amino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]ethanesulfonic acid |
| SMILES | CCS(=O)(=O)NCCN(CCO)c1nc(NCCS(=O)(=O)O)nc(Nc2ccc(O)cc2)n1 |
| InChI | InChI=1S/C17H27N7O7S2/c1-2-32(27,28)19-7-9-24(10-11-25)17-22-15(18-8-12-33(29,30)31)21-16(23-17)20-13-3-5-14(26)6-4-13/h3-6,19,25-26H,2,7-12H2,1H3,(H,29,30,31)(H2,18,20,21,22,23) |
| InChIKey | AINCDHBPWMTCBH-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 206.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|