About 3-ethylsulfonylpropyl 2-methylsulfonylethyl carbonate
3-ethylsulfonylpropyl 2-methylsulfonylethyl carbonate (PubChem CID 22979558) has the molecular formula C9H18O7S2
and a molecular weight of 302.37 g/mol. Its IUPAC name is 3-ethylsulfonylpropyl 2-methylsulfonylethyl carbonate.
Molecular Properties
| Compound Name | 3-ethylsulfonylpropyl 2-methylsulfonylethyl carbonate |
| PubChem CID | 22979558 |
| Molecular Formula | C9H18O7S2 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 3-ethylsulfonylpropyl 2-methylsulfonylethyl carbonate |
| SMILES | CCS(=O)(=O)CCCOC(=O)OCCS(C)(=O)=O |
| InChI | InChI=1S/C9H18O7S2/c1-3-18(13,14)7-4-5-15-9(10)16-6-8-17(2,11)12/h3-8H2,1-2H3 |
| InChIKey | HDVDLEBKPQUXRW-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylsulfonylpropyl 2-methylsulfonylethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylsulfonylpropyl 2-methylsulfonylethyl carbonate?
The IUPAC name of 3-ethylsulfonylpropyl 2-methylsulfonylethyl carbonate (CID 22979558) is 3-ethylsulfonylpropyl 2-methylsulfonylethyl carbonate.
What is the SMILES notation for 3-ethylsulfonylpropyl 2-methylsulfonylethyl carbonate?
The canonical SMILES for 3-ethylsulfonylpropyl 2-methylsulfonylethyl carbonate is CCS(=O)(=O)CCCOC(=O)OCCS(C)(=O)=O.
What is the InChIKey of 3-ethylsulfonylpropyl 2-methylsulfonylethyl carbonate?
The InChIKey is HDVDLEBKPQUXRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O7S2/c1-3-18(13,14)7-4-5-15-9(10)16-6-8-17(2,11)12/h3-8H2,1-2H3.
What are the key properties of 3-ethylsulfonylpropyl 2-methylsulfonylethyl carbonate?
3-ethylsulfonylpropyl 2-methylsulfonylethyl carbonate has a molecular weight of 302.37 g/mol, XLogP of 0.01, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylsulfonylpropyl 2-methylsulfonylethyl carbonate is sourced from PubChem (CID 22979558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).