About [dimethyl(phenyl)silyl] 2-(ethylsulfonyloxymethyl)-2-methyl-3-oxobutanoate
[dimethyl(phenyl)silyl] 2-(ethylsulfonyloxymethyl)-2-methyl-3-oxobutanoate (PubChem CID 22979642) has the molecular formula C16H24O6SSi
and a molecular weight of 372.52 g/mol. Its IUPAC name is [dimethyl(phenyl)silyl] 2-(ethylsulfonyloxymethyl)-2-methyl-3-oxobutanoate.
Molecular Properties
| Compound Name | [dimethyl(phenyl)silyl] 2-(ethylsulfonyloxymethyl)-2-methyl-3-oxobutanoate |
| PubChem CID | 22979642 |
| Molecular Formula | C16H24O6SSi |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | [dimethyl(phenyl)silyl] 2-(ethylsulfonyloxymethyl)-2-methyl-3-oxobutanoate |
| SMILES | CCS(=O)(=O)OCC(C)(C(C)=O)C(=O)O[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C16H24O6SSi/c1-6-23(19,20)21-12-16(3,13(2)17)15(18)22-24(4,5)14-10-8-7-9-11-14/h7-11H,6,12H2,1-5H3 |
| InChIKey | FTHUOXOGOOTJPP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [dimethyl(phenyl)silyl] 2-(ethylsulfonyloxymethyl)-2-methyl-3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dimethyl(phenyl)silyl] 2-(ethylsulfonyloxymethyl)-2-methyl-3-oxobutanoate?
The IUPAC name of [dimethyl(phenyl)silyl] 2-(ethylsulfonyloxymethyl)-2-methyl-3-oxobutanoate (CID 22979642) is [dimethyl(phenyl)silyl] 2-(ethylsulfonyloxymethyl)-2-methyl-3-oxobutanoate.
What is the SMILES notation for [dimethyl(phenyl)silyl] 2-(ethylsulfonyloxymethyl)-2-methyl-3-oxobutanoate?
The canonical SMILES for [dimethyl(phenyl)silyl] 2-(ethylsulfonyloxymethyl)-2-methyl-3-oxobutanoate is CCS(=O)(=O)OCC(C)(C(C)=O)C(=O)O[Si](C)(C)c1ccccc1.
What is the InChIKey of [dimethyl(phenyl)silyl] 2-(ethylsulfonyloxymethyl)-2-methyl-3-oxobutanoate?
The InChIKey is FTHUOXOGOOTJPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O6SSi/c1-6-23(19,20)21-12-16(3,13(2)17)15(18)22-24(4,5)14-10-8-7-9-11-14/h7-11H,6,12H2,1-5H3.
What are the key properties of [dimethyl(phenyl)silyl] 2-(ethylsulfonyloxymethyl)-2-methyl-3-oxobutanoate?
[dimethyl(phenyl)silyl] 2-(ethylsulfonyloxymethyl)-2-methyl-3-oxobutanoate has a molecular weight of 372.52 g/mol, XLogP of 1.60, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [dimethyl(phenyl)silyl] 2-(ethylsulfonyloxymethyl)-2-methyl-3-oxobutanoate is sourced from PubChem (CID 22979642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).