C10H19NOS — CID 22980207
3-methyl-1-(1-methylidene-1,4-thiazinan-4-yl)butan-1-one (PubChem CID 22980207) has the molecular formula C10H19NOS and a molecular weight of 201.33 g/mol. Its IUPAC name is 3-methyl-1-(1-methylidene-1,4-thiazinan-4-yl)butan-1-one.
| Compound Name | 3-methyl-1-(1-methylidene-1,4-thiazinan-4-yl)butan-1-one |
|---|---|
| PubChem CID | 22980207 |
| Molecular Formula | C10H19NOS |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 3-methyl-1-(1-methylidene-1,4-thiazinan-4-yl)butan-1-one |
| SMILES | C=S1CCN(C(=O)CC(C)C)CC1 |
| InChI | InChI=1S/C10H19NOS/c1-9(2)8-10(12)11-4-6-13(3)7-5-11/h9H,3-8H2,1-2H3 |
| InChIKey | SVXJNYBCNGOOMX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|