About 2-(dimethylamino)-N'-ethylethanimidamide
2-(dimethylamino)-N'-ethylethanimidamide (PubChem CID 22980368) has the molecular formula C6H15N3
and a molecular weight of 129.21 g/mol. Its IUPAC name is 2-(dimethylamino)-N'-ethylethanimidamide.
Molecular Properties
| Compound Name | 2-(dimethylamino)-N'-ethylethanimidamide |
| PubChem CID | 22980368 |
| Molecular Formula | C6H15N3 |
| Molecular Weight | 129.21 g/mol |
| Exact Mass | 129.13 |
| IUPAC Name | 2-(dimethylamino)-N'-ethylethanimidamide |
| SMILES | CC/N=C(/N)CN(C)C |
| InChI | InChI=1S/C6H15N3/c1-4-8-6(7)5-9(2)3/h4-5H2,1-3H3,(H2,7,8) |
| InChIKey | IAKQPZHCYPLMPT-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.21 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)-N'-ethylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-N'-ethylethanimidamide?
The IUPAC name of 2-(dimethylamino)-N'-ethylethanimidamide (CID 22980368) is 2-(dimethylamino)-N'-ethylethanimidamide.
What is the SMILES notation for 2-(dimethylamino)-N'-ethylethanimidamide?
The canonical SMILES for 2-(dimethylamino)-N'-ethylethanimidamide is CC/N=C(/N)CN(C)C.
What is the InChIKey of 2-(dimethylamino)-N'-ethylethanimidamide?
The InChIKey is IAKQPZHCYPLMPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N3/c1-4-8-6(7)5-9(2)3/h4-5H2,1-3H3,(H2,7,8).
What are the key properties of 2-(dimethylamino)-N'-ethylethanimidamide?
2-(dimethylamino)-N'-ethylethanimidamide has a molecular weight of 129.21 g/mol, XLogP of -0.07, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-N'-ethylethanimidamide is sourced from PubChem (CID 22980368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).