C12H16N2 — CID 22980391
1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-6-amine (PubChem CID 22980391) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-6-amine.
| Compound Name | 1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-6-amine |
|---|---|
| PubChem CID | 22980391 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-6-amine |
| SMILES | Nc1ccc2c3c1CCCN3CCC2 |
| InChI | InChI=1S/C12H16N2/c13-11-6-5-9-3-1-7-14-8-2-4-10(11)12(9)14/h5-6H,1-4,7-8,13H2 |
| InChIKey | FAPSTFZBJMPYMU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|