C39H57ClN4O4Si3 — CID 22980652
2-[[6-[5-chloro-2-methyl-4-(2-trimethylsilylethoxymethoxy)phenyl]-3-[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]indazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 22980652) has the molecular formula C39H57ClN4O4Si3 and a molecular weight of 765.62 g/mol. Its IUPAC name is 2-[[6-[5-chloro-2-methyl-4-(2-trimethylsilylethoxymethoxy)phenyl]-3-[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]indazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[6-[5-chloro-2-methyl-4-(2-trimethylsilylethoxymethoxy)phenyl]-3-[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]indazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 22980652 |
| Molecular Formula | C39H57ClN4O4Si3 |
| Molecular Weight | 765.62 g/mol |
| Exact Mass | 764.34 |
| IUPAC Name | 2-[[6-[5-chloro-2-methyl-4-(2-trimethylsilylethoxymethoxy)phenyl]-3-[1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]indazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1cc(OCOCC[Si](C)(C)C)c(Cl)cc1-c1ccc2c(-c3nc4ccccc4n3COCC[Si](C)(C)C)nn(COCC[Si](C)(C)C)c2c1 |
| InChI | InChI=1S/C39H57ClN4O4Si3/c1-29-23-37(48-28-47-19-22-51(8,9)10)33(40)25-32(29)30-15-16-31-36(24-30)44(27-46-18-21-50(5,6)7)42-38(31)39-41-34-13-11-12-14-35(34)43(39)26-45-17-20-49(2,3)4/h11-16,23-25H,17-22,26-28H2,1-10H3 |
| InChIKey | YCADQHXCKCDVQG-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 72.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.62 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|