About 2-methyl-N-[2-(phenylsulfanylmethyl)phenyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide
2-methyl-N-[2-(phenylsulfanylmethyl)phenyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide (PubChem CID 22980778) has the molecular formula C19H15F3N2OS2
and a molecular weight of 408.47 g/mol. Its IUPAC name is 2-methyl-N-[2-(phenylsulfanylmethyl)phenyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-methyl-N-[2-(phenylsulfanylmethyl)phenyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide |
| PubChem CID | 22980778 |
| Molecular Formula | C19H15F3N2OS2 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 2-methyl-N-[2-(phenylsulfanylmethyl)phenyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C(F)(F)F)c(C(=O)Nc2ccccc2CSc2ccccc2)s1 |
| InChI | InChI=1S/C19H15F3N2OS2/c1-12-23-17(19(20,21)22)16(27-12)18(25)24-15-10-6-5-7-13(15)11-26-14-8-3-2-4-9-14/h2-10H,11H2,1H3,(H,24,25) |
| InChIKey | DLMCXJOSBABFOF-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-N-[2-(phenylsulfanylmethyl)phenyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[2-(phenylsulfanylmethyl)phenyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide?
The IUPAC name of 2-methyl-N-[2-(phenylsulfanylmethyl)phenyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide (CID 22980778) is 2-methyl-N-[2-(phenylsulfanylmethyl)phenyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 2-methyl-N-[2-(phenylsulfanylmethyl)phenyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide?
The canonical SMILES for 2-methyl-N-[2-(phenylsulfanylmethyl)phenyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide is Cc1nc(C(F)(F)F)c(C(=O)Nc2ccccc2CSc2ccccc2)s1.
What is the InChIKey of 2-methyl-N-[2-(phenylsulfanylmethyl)phenyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide?
The InChIKey is DLMCXJOSBABFOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15F3N2OS2/c1-12-23-17(19(20,21)22)16(27-12)18(25)24-15-10-6-5-7-13(15)11-26-14-8-3-2-4-9-14/h2-10H,11H2,1H3,(H,24,25).
What are the key properties of 2-methyl-N-[2-(phenylsulfanylmethyl)phenyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide?
2-methyl-N-[2-(phenylsulfanylmethyl)phenyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide has a molecular weight of 408.47 g/mol, XLogP of 6.01, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[2-(phenylsulfanylmethyl)phenyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 22980778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).