About 3-(difluoromethyl)-1,4-dimethylpyrazole
3-(difluoromethyl)-1,4-dimethylpyrazole (PubChem CID 22980781) has the molecular formula C6H8F2N2
and a molecular weight of 146.14 g/mol. Its IUPAC name is 3-(difluoromethyl)-1,4-dimethylpyrazole.
Molecular Properties
| Compound Name | 3-(difluoromethyl)-1,4-dimethylpyrazole |
| PubChem CID | 22980781 |
| Molecular Formula | C6H8F2N2 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 3-(difluoromethyl)-1,4-dimethylpyrazole |
| SMILES | Cc1cn(C)nc1C(F)F |
| InChI | InChI=1S/C6H8F2N2/c1-4-3-10(2)9-5(4)6(7)8/h3,6H,1-2H3 |
| InChIKey | ABFCPDYYBWSWKZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(difluoromethyl)-1,4-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethyl)-1,4-dimethylpyrazole?
The IUPAC name of 3-(difluoromethyl)-1,4-dimethylpyrazole (CID 22980781) is 3-(difluoromethyl)-1,4-dimethylpyrazole.
What is the SMILES notation for 3-(difluoromethyl)-1,4-dimethylpyrazole?
The canonical SMILES for 3-(difluoromethyl)-1,4-dimethylpyrazole is Cc1cn(C)nc1C(F)F.
What is the InChIKey of 3-(difluoromethyl)-1,4-dimethylpyrazole?
The InChIKey is ABFCPDYYBWSWKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F2N2/c1-4-3-10(2)9-5(4)6(7)8/h3,6H,1-2H3.
What are the key properties of 3-(difluoromethyl)-1,4-dimethylpyrazole?
3-(difluoromethyl)-1,4-dimethylpyrazole has a molecular weight of 146.14 g/mol, XLogP of 1.67, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethyl)-1,4-dimethylpyrazole is sourced from PubChem (CID 22980781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).