C27H24F3N5O2S — CID 22980826
2-[1-[[1-(3-ethanimidoylphenyl)-3-(trifluoromethyl)pyrazol-5-yl]methyl]-2,3-dihydroindol-5-yl]benzenesulfonamide (PubChem CID 22980826) has the molecular formula C27H24F3N5O2S and a molecular weight of 539.58 g/mol. Its IUPAC name is 2-[1-[[1-(3-ethanimidoylphenyl)-3-(trifluoromethyl)pyrazol-5-yl]methyl]-2,3-dihydroindol-5-yl]benzenesulfonamide.
| Compound Name | 2-[1-[[1-(3-ethanimidoylphenyl)-3-(trifluoromethyl)pyrazol-5-yl]methyl]-2,3-dihydroindol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 22980826 |
| Molecular Formula | C27H24F3N5O2S |
| Molecular Weight | 539.58 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 2-[1-[[1-(3-ethanimidoylphenyl)-3-(trifluoromethyl)pyrazol-5-yl]methyl]-2,3-dihydroindol-5-yl]benzenesulfonamide |
| SMILES | [H]/N=C(\C)c1cccc(-n2nc(C(F)(F)F)cc2CN2CCc3cc(-c4ccccc4S(N)(=O)=O)ccc32)c1 |
| InChI | InChI=1S/C27H24F3N5O2S/c1-17(31)18-5-4-6-21(14-18)35-22(15-26(33-35)27(28,29)30)16-34-12-11-20-13-19(9-10-24(20)34)23-7-2-3-8-25(23)38(32,36)37/h2-10,13-15,31H,11-12,16H2,1H3,(H2,32,36,37)/b31-17+ |
| InChIKey | JCHNBWSKFGHTJP-KBVAKVRCSA-N |
| XLogP | 5.16 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.58 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|