C24H17F3N2O4 — CID 22981061
N-[3-[(1,3-dioxoisoindol-2-yl)methyl]-4-phenylmethoxyphenyl]-2,2,2-trifluoroacetamide (PubChem CID 22981061) has the molecular formula C24H17F3N2O4 and a molecular weight of 454.40 g/mol. Its IUPAC name is N-[3-[(1,3-dioxoisoindol-2-yl)methyl]-4-phenylmethoxyphenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[(1,3-dioxoisoindol-2-yl)methyl]-4-phenylmethoxyphenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 22981061 |
| Molecular Formula | C24H17F3N2O4 |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | N-[3-[(1,3-dioxoisoindol-2-yl)methyl]-4-phenylmethoxyphenyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1cc(NC(=O)C(F)(F)F)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H17F3N2O4/c25-24(26,27)23(32)28-17-10-11-20(33-14-15-6-2-1-3-7-15)16(12-17)13-29-21(30)18-8-4-5-9-19(18)22(29)31/h1-12H,13-14H2,(H,28,32) |
| InChIKey | DDCSLLFYDWYNDX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|