About 2-ethyl-1,4-dimethylpyrrolidine
2-ethyl-1,4-dimethylpyrrolidine (PubChem CID 22981539) has the molecular formula C8H17N
and a molecular weight of 127.23 g/mol. Its IUPAC name is 2-ethyl-1,4-dimethylpyrrolidine.
Molecular Properties
| Compound Name | 2-ethyl-1,4-dimethylpyrrolidine |
| PubChem CID | 22981539 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | 2-ethyl-1,4-dimethylpyrrolidine |
| SMILES | CCC1CC(C)CN1C |
| InChI | InChI=1S/C8H17N/c1-4-8-5-7(2)6-9(8)3/h7-8H,4-6H2,1-3H3 |
| InChIKey | PKKSLYCYJFNJGH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-1,4-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1,4-dimethylpyrrolidine?
The IUPAC name of 2-ethyl-1,4-dimethylpyrrolidine (CID 22981539) is 2-ethyl-1,4-dimethylpyrrolidine.
What is the SMILES notation for 2-ethyl-1,4-dimethylpyrrolidine?
The canonical SMILES for 2-ethyl-1,4-dimethylpyrrolidine is CCC1CC(C)CN1C.
What is the InChIKey of 2-ethyl-1,4-dimethylpyrrolidine?
The InChIKey is PKKSLYCYJFNJGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N/c1-4-8-5-7(2)6-9(8)3/h7-8H,4-6H2,1-3H3.
What are the key properties of 2-ethyl-1,4-dimethylpyrrolidine?
2-ethyl-1,4-dimethylpyrrolidine has a molecular weight of 127.23 g/mol, XLogP of 1.74, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1,4-dimethylpyrrolidine is sourced from PubChem (CID 22981539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).