About 1-phenylthiiran-1-ium
1-phenylthiiran-1-ium (PubChem CID 22981884) has the molecular formula C8H9S+
and a molecular weight of 137.23 g/mol. Its IUPAC name is 1-phenylthiiran-1-ium.
Molecular Properties
| Compound Name | 1-phenylthiiran-1-ium |
| PubChem CID | 22981884 |
| Molecular Formula | C8H9S+ |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.04 |
| IUPAC Name | 1-phenylthiiran-1-ium |
| SMILES | c1ccc([S+]2CC2)cc1 |
| InChI | InChI=1S/C8H9S/c1-2-4-8(5-3-1)9-6-7-9/h1-5H,6-7H2/q+1 |
| InChIKey | HOEOKINJGMOAOF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylthiiran-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylthiiran-1-ium?
The IUPAC name of 1-phenylthiiran-1-ium (CID 22981884) is 1-phenylthiiran-1-ium.
What is the SMILES notation for 1-phenylthiiran-1-ium?
The canonical SMILES for 1-phenylthiiran-1-ium is c1ccc([S+]2CC2)cc1.
What is the InChIKey of 1-phenylthiiran-1-ium?
The InChIKey is HOEOKINJGMOAOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9S/c1-2-4-8(5-3-1)9-6-7-9/h1-5H,6-7H2/q+1.
What are the key properties of 1-phenylthiiran-1-ium?
1-phenylthiiran-1-ium has a molecular weight of 137.23 g/mol, XLogP of 1.68, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylthiiran-1-ium is sourced from PubChem (CID 22981884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).