About 2-(3-methyl-2-phenylmorpholin-4-ium-4-yl)ethyl 2-phenylbutanoate chloride
2-(3-methyl-2-phenylmorpholin-4-ium-4-yl)ethyl 2-phenylbutanoate chloride (PubChem CID 22982) has the molecular formula C23H30ClNO3
and a molecular weight of 403.95 g/mol. Its IUPAC name is 2-(3-methyl-2-phenylmorpholin-4-ium-4-yl)ethyl 2-phenylbutanoate chloride.
Molecular Properties
| Compound Name | 2-(3-methyl-2-phenylmorpholin-4-ium-4-yl)ethyl 2-phenylbutanoate chloride |
| PubChem CID | 22982 |
| Molecular Formula | C23H30ClNO3 |
| Molecular Weight | 403.95 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 2-(3-methyl-2-phenylmorpholin-4-ium-4-yl)ethyl 2-phenylbutanoate chloride |
| SMILES | CCC(C(=O)OCC[NH+]1CCOC(c2ccccc2)C1C)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C23H29NO3.ClH/c1-3-21(19-10-6-4-7-11-19)23(25)27-17-15-24-14-16-26-22(18(24)2)20-12-8-5-9-13-20;/h4-13,18,21-22H,3,14-17H2,1-2H3;1H |
| InChIKey | QYNMGTGFHCYFIE-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.95 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-methyl-2-phenylmorpholin-4-ium-4-yl)ethyl 2-phenylbutanoate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methyl-2-phenylmorpholin-4-ium-4-yl)ethyl 2-phenylbutanoate chloride?
The IUPAC name of 2-(3-methyl-2-phenylmorpholin-4-ium-4-yl)ethyl 2-phenylbutanoate chloride (CID 22982) is 2-(3-methyl-2-phenylmorpholin-4-ium-4-yl)ethyl 2-phenylbutanoate chloride.
What is the SMILES notation for 2-(3-methyl-2-phenylmorpholin-4-ium-4-yl)ethyl 2-phenylbutanoate chloride?
The canonical SMILES for 2-(3-methyl-2-phenylmorpholin-4-ium-4-yl)ethyl 2-phenylbutanoate chloride is CCC(C(=O)OCC[NH+]1CCOC(c2ccccc2)C1C)c1ccccc1.[Cl-].
What is the InChIKey of 2-(3-methyl-2-phenylmorpholin-4-ium-4-yl)ethyl 2-phenylbutanoate chloride?
The InChIKey is QYNMGTGFHCYFIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29NO3.ClH/c1-3-21(19-10-6-4-7-11-19)23(25)27-17-15-24-14-16-26-22(18(24)2)20-12-8-5-9-13-20;/h4-13,18,21-22H,3,14-17H2,1-2H3;1H.
What are the key properties of 2-(3-methyl-2-phenylmorpholin-4-ium-4-yl)ethyl 2-phenylbutanoate chloride?
2-(3-methyl-2-phenylmorpholin-4-ium-4-yl)ethyl 2-phenylbutanoate chloride has a molecular weight of 403.95 g/mol, XLogP of -0.23, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyl-2-phenylmorpholin-4-ium-4-yl)ethyl 2-phenylbutanoate chloride is sourced from PubChem (CID 22982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).