About 1-methoxypropan-2-yl 4-(2-hydroxypropanoyloxy)-3-oxopentanoate
1-methoxypropan-2-yl 4-(2-hydroxypropanoyloxy)-3-oxopentanoate (PubChem CID 22982093) has the molecular formula C12H20O7
and a molecular weight of 276.28 g/mol. Its IUPAC name is 1-methoxypropan-2-yl 4-(2-hydroxypropanoyloxy)-3-oxopentanoate.
Molecular Properties
| Compound Name | 1-methoxypropan-2-yl 4-(2-hydroxypropanoyloxy)-3-oxopentanoate |
| PubChem CID | 22982093 |
| Molecular Formula | C12H20O7 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 1-methoxypropan-2-yl 4-(2-hydroxypropanoyloxy)-3-oxopentanoate |
| SMILES | COCC(C)OC(=O)CC(=O)C(C)OC(=O)C(C)O |
| InChI | InChI=1S/C12H20O7/c1-7(6-17-4)18-11(15)5-10(14)9(3)19-12(16)8(2)13/h7-9,13H,5-6H2,1-4H3 |
| InChIKey | RAFATBYZUGCTAZ-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxypropan-2-yl 4-(2-hydroxypropanoyloxy)-3-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropan-2-yl 4-(2-hydroxypropanoyloxy)-3-oxopentanoate?
The IUPAC name of 1-methoxypropan-2-yl 4-(2-hydroxypropanoyloxy)-3-oxopentanoate (CID 22982093) is 1-methoxypropan-2-yl 4-(2-hydroxypropanoyloxy)-3-oxopentanoate.
What is the SMILES notation for 1-methoxypropan-2-yl 4-(2-hydroxypropanoyloxy)-3-oxopentanoate?
The canonical SMILES for 1-methoxypropan-2-yl 4-(2-hydroxypropanoyloxy)-3-oxopentanoate is COCC(C)OC(=O)CC(=O)C(C)OC(=O)C(C)O.
What is the InChIKey of 1-methoxypropan-2-yl 4-(2-hydroxypropanoyloxy)-3-oxopentanoate?
The InChIKey is RAFATBYZUGCTAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O7/c1-7(6-17-4)18-11(15)5-10(14)9(3)19-12(16)8(2)13/h7-9,13H,5-6H2,1-4H3.
What are the key properties of 1-methoxypropan-2-yl 4-(2-hydroxypropanoyloxy)-3-oxopentanoate?
1-methoxypropan-2-yl 4-(2-hydroxypropanoyloxy)-3-oxopentanoate has a molecular weight of 276.28 g/mol, XLogP of -0.16, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropan-2-yl 4-(2-hydroxypropanoyloxy)-3-oxopentanoate is sourced from PubChem (CID 22982093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).