2-(2,5-dioxopyrrol-1-yl)-2-methylpropane-1-sulfonic acid

C8H11NO5S — CID 22982188

IUPAC2-(2,5-dioxopyrrol-1-yl)-2-methylpropane-1-sulfonic acid
SMILESCC(C)(CS(=O)(=O)O)N1C(=O)C=CC1=O
InChIInChI=1S/C8H11NO5S/c1-8(2,5-15(12,13)14)9-6(10)3-4-7(9)11/h3-4H,5H2,1-2H3,(H,12,13,14)
InChIKeyPSSAZUBEPXEGAB-UHFFFAOYSA-N
MW233.24 g/mol
LogP-0.42
Rot. Bonds3

About 2-(2,5-dioxopyrrol-1-yl)-2-methylpropane-1-sulfonic acid

2-(2,5-dioxopyrrol-1-yl)-2-methylpropane-1-sulfonic acid (PubChem CID 22982188) has the molecular formula C8H11NO5S and a molecular weight of 233.24 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)-2-methylpropane-1-sulfonic acid.

Molecular Properties

Compound Name2-(2,5-dioxopyrrol-1-yl)-2-methylpropane-1-sulfonic acid
PubChem CID22982188
Molecular FormulaC8H11NO5S
Molecular Weight233.24 g/mol
Exact Mass233.04
IUPAC Name2-(2,5-dioxopyrrol-1-yl)-2-methylpropane-1-sulfonic acid
SMILESCC(C)(CS(=O)(=O)O)N1C(=O)C=CC1=O
InChIInChI=1S/C8H11NO5S/c1-8(2,5-15(12,13)14)9-6(10)3-4-7(9)11/h3-4H,5H2,1-2H3,(H,12,13,14)
InChIKeyPSSAZUBEPXEGAB-UHFFFAOYSA-N
XLogP-0.42
TPSA91.75 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.24
LogP ≤ 5-0.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-(2,5-dioxopyrrol-1-yl)-2-methylpropane-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,5-dioxopyrrol-1-yl)-2-methylpropane-1-sulfonic acid?
The IUPAC name of 2-(2,5-dioxopyrrol-1-yl)-2-methylpropane-1-sulfonic acid (CID 22982188) is 2-(2,5-dioxopyrrol-1-yl)-2-methylpropane-1-sulfonic acid.
What is the SMILES notation for 2-(2,5-dioxopyrrol-1-yl)-2-methylpropane-1-sulfonic acid?
The canonical SMILES for 2-(2,5-dioxopyrrol-1-yl)-2-methylpropane-1-sulfonic acid is CC(C)(CS(=O)(=O)O)N1C(=O)C=CC1=O.
What is the InChIKey of 2-(2,5-dioxopyrrol-1-yl)-2-methylpropane-1-sulfonic acid?
The InChIKey is PSSAZUBEPXEGAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO5S/c1-8(2,5-15(12,13)14)9-6(10)3-4-7(9)11/h3-4H,5H2,1-2H3,(H,12,13,14).
What are the key properties of 2-(2,5-dioxopyrrol-1-yl)-2-methylpropane-1-sulfonic acid?
2-(2,5-dioxopyrrol-1-yl)-2-methylpropane-1-sulfonic acid has a molecular weight of 233.24 g/mol, XLogP of -0.42, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dioxopyrrol-1-yl)-2-methylpropane-1-sulfonic acid is sourced from PubChem (CID 22982188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).