C15H14Cl6N4O2 — CID 22982226
2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-N-(2-hydroxyethyl)anilino]ethanol (PubChem CID 22982226) has the molecular formula C15H14Cl6N4O2 and a molecular weight of 495.02 g/mol. Its IUPAC name is 2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-N-(2-hydroxyethyl)anilino]ethanol.
| Compound Name | 2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-N-(2-hydroxyethyl)anilino]ethanol |
|---|---|
| PubChem CID | 22982226 |
| Molecular Formula | C15H14Cl6N4O2 |
| Molecular Weight | 495.02 g/mol |
| Exact Mass | 491.92 |
| IUPAC Name | 2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-N-(2-hydroxyethyl)anilino]ethanol |
| SMILES | OCCN(CCO)c1ccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/C15H14Cl6N4O2/c16-14(17,18)12-22-11(23-13(24-12)15(19,20)21)9-1-3-10(4-2-9)25(5-7-26)6-8-27/h1-4,26-27H,5-8H2 |
| InChIKey | SBGWYVRQXDZURT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 82.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.02 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|