About 5,5-dimethylthiolan-3-one
5,5-dimethylthiolan-3-one (PubChem CID 22982778) has the molecular formula C6H10OS
and a molecular weight of 130.21 g/mol. Its IUPAC name is 5,5-dimethylthiolan-3-one.
Molecular Properties
| Compound Name | 5,5-dimethylthiolan-3-one |
| PubChem CID | 22982778 |
| Molecular Formula | C6H10OS |
| Molecular Weight | 130.21 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | 5,5-dimethylthiolan-3-one |
| SMILES | CC1(C)CC(=O)CS1 |
| InChI | InChI=1S/C6H10OS/c1-6(2)3-5(7)4-8-6/h3-4H2,1-2H3 |
| InChIKey | GXWNDIVHXHDXLJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.21 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,5-dimethylthiolan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethylthiolan-3-one?
The IUPAC name of 5,5-dimethylthiolan-3-one (CID 22982778) is 5,5-dimethylthiolan-3-one.
What is the SMILES notation for 5,5-dimethylthiolan-3-one?
The canonical SMILES for 5,5-dimethylthiolan-3-one is CC1(C)CC(=O)CS1.
What is the InChIKey of 5,5-dimethylthiolan-3-one?
The InChIKey is GXWNDIVHXHDXLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10OS/c1-6(2)3-5(7)4-8-6/h3-4H2,1-2H3.
What are the key properties of 5,5-dimethylthiolan-3-one?
5,5-dimethylthiolan-3-one has a molecular weight of 130.21 g/mol, XLogP of 1.47, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethylthiolan-3-one is sourced from PubChem (CID 22982778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).