About (2-methyl-3-oxopropyl) carbamate
(2-methyl-3-oxopropyl) carbamate (PubChem CID 22982919) has the molecular formula C5H9NO3
and a molecular weight of 131.13 g/mol. Its IUPAC name is (2-methyl-3-oxopropyl) carbamate.
Molecular Properties
| Compound Name | (2-methyl-3-oxopropyl) carbamate |
| PubChem CID | 22982919 |
| Molecular Formula | C5H9NO3 |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | (2-methyl-3-oxopropyl) carbamate |
| SMILES | CC(C=O)COC(N)=O |
| InChI | InChI=1S/C5H9NO3/c1-4(2-7)3-9-5(6)8/h2,4H,3H2,1H3,(H2,6,8) |
| InChIKey | PNZNMOGJAPJJSE-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-3-oxopropyl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-3-oxopropyl) carbamate?
The IUPAC name of (2-methyl-3-oxopropyl) carbamate (CID 22982919) is (2-methyl-3-oxopropyl) carbamate.
What is the SMILES notation for (2-methyl-3-oxopropyl) carbamate?
The canonical SMILES for (2-methyl-3-oxopropyl) carbamate is CC(C=O)COC(N)=O.
What is the InChIKey of (2-methyl-3-oxopropyl) carbamate?
The InChIKey is PNZNMOGJAPJJSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO3/c1-4(2-7)3-9-5(6)8/h2,4H,3H2,1H3,(H2,6,8).
What are the key properties of (2-methyl-3-oxopropyl) carbamate?
(2-methyl-3-oxopropyl) carbamate has a molecular weight of 131.13 g/mol, XLogP of -0.08, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-3-oxopropyl) carbamate is sourced from PubChem (CID 22982919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).