C25H47BrOSi — CID 22983259
[(6S)-6-[(1R,2E,7aR)-2-(bromomethylidene)-7a-methyl-3,3a,4,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-yl]oxy-triethylsilane (PubChem CID 22983259) has the molecular formula C25H47BrOSi and a molecular weight of 471.64 g/mol. Its IUPAC name is [(6S)-6-[(1R,2E,7aR)-2-(bromomethylidene)-7a-methyl-3,3a,4,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-yl]oxy-triethylsilane.
| Compound Name | [(6S)-6-[(1R,2E,7aR)-2-(bromomethylidene)-7a-methyl-3,3a,4,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 22983259 |
| Molecular Formula | C25H47BrOSi |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | [(6S)-6-[(1R,2E,7aR)-2-(bromomethylidene)-7a-methyl-3,3a,4,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)OC(C)(C)CCC[C@H](C)[C@H]1/C(=C/Br)CC2CCCC[C@]21C |
| InChI | InChI=1S/C25H47BrOSi/c1-8-28(9-2,10-3)27-24(5,6)16-13-14-20(4)23-21(19-26)18-22-15-11-12-17-25(22,23)7/h19-20,22-23H,8-18H2,1-7H3/b21-19+/t20-,22?,23-,25+/m0/s1 |
| InChIKey | AAAFCVJBLNUXKA-NGUWAZHLSA-N |
| XLogP | 9.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|