About (4-iminocyclohexa-2,5-dien-1-ylidene)azanium
(4-iminocyclohexa-2,5-dien-1-ylidene)azanium (PubChem CID 22983322) has the molecular formula C6H7N2+
and a molecular weight of 107.14 g/mol. Its IUPAC name is (4-iminocyclohexa-2,5-dien-1-ylidene)azanium.
Molecular Properties
| Compound Name | (4-iminocyclohexa-2,5-dien-1-ylidene)azanium |
| PubChem CID | 22983322 |
| Molecular Formula | C6H7N2+ |
| Molecular Weight | 107.14 g/mol |
| Exact Mass | 107.06 |
| IUPAC Name | (4-iminocyclohexa-2,5-dien-1-ylidene)azanium |
| SMILES | [H]N=C1C=CC(=[NH2+])C=C1 |
| InChI | InChI=1S/C6H6N2/c7-5-1-2-6(8)4-3-5/h1-4,7-8H/p+1/b7-5-,8-6? |
| InChIKey | ACFNYGLBKAZUDY-WDFIMKRQSA-O |
| XLogP | -0.67 |
| TPSA | 49.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.14 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (4-iminocyclohexa-2,5-dien-1-ylidene)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-iminocyclohexa-2,5-dien-1-ylidene)azanium?
The IUPAC name of (4-iminocyclohexa-2,5-dien-1-ylidene)azanium (CID 22983322) is (4-iminocyclohexa-2,5-dien-1-ylidene)azanium.
What is the SMILES notation for (4-iminocyclohexa-2,5-dien-1-ylidene)azanium?
The canonical SMILES for (4-iminocyclohexa-2,5-dien-1-ylidene)azanium is [H]N=C1C=CC(=[NH2+])C=C1.
What is the InChIKey of (4-iminocyclohexa-2,5-dien-1-ylidene)azanium?
The InChIKey is ACFNYGLBKAZUDY-WDFIMKRQSA-O. The full InChI is InChI=1S/C6H6N2/c7-5-1-2-6(8)4-3-5/h1-4,7-8H/p+1/b7-5-,8-6?.
What are the key properties of (4-iminocyclohexa-2,5-dien-1-ylidene)azanium?
(4-iminocyclohexa-2,5-dien-1-ylidene)azanium has a molecular weight of 107.14 g/mol, XLogP of -0.67, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-iminocyclohexa-2,5-dien-1-ylidene)azanium is sourced from PubChem (CID 22983322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).